https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Octotiamine%2Fen Octotiamine/en - Revision history 2026-04-18T18:38:11Z Revision history for this page on the wiki MediaWiki 1.43.0 https://wiki.tiffa.net/w/index.php?title=Octotiamine/en&diff=133310&oldid=prev FuzzyBot: Updating to match new version of source page 2024-04-03T01:34:53Z <p>Updating to match new version of source page</p> <p><b>New page</b></p><div>&lt;languages /&gt;<br /> {{Short description|Chemical compound}}<br /> {{Drugbox<br /> | IUPAC_name = methyl 6-(acetylsulfanyl)-8-&lt;nowiki/&gt;{[(2E)-2-&lt;nowiki/&gt;{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate<br /> | image = Octotiamine.svg<br /> | width = 250<br /> | image2 = Octotiamine 3D.png<br /> | width2 = 160<br /> | CAS_number = 137-86-0<br /> | UNII_Ref = {{fdacite|correct|FDA}}<br /> | UNII = UN1Q7096GA<br /> | ATC_prefix = None<br /> | ATC_suffix = <br /> | PubChem = 3034020<br /> | DrugBank = <br /> | ChemSpiderID = 2298574<br /> | chemical_formula =<br /> | C=23 | H=36 | N=4 | O=5 | S=3 <br /> | SMILES = Cc1ncc(c(n1)N)CN(C=O)/C(=C(\CCO)/SSCCC(CCCCC(=O)OC)SC(=O)C)/C<br /> | StdInChI = 1S/C23H36N4O5S3/c1-16(27(15-29)14-19-13-25-17(2)26-23(19)24)21(9-11-28)35-33-12-10-20(34-18(3)30)7-5-6-8-22(31)32-4/h13,15,20,28H,5-12,14H2,1-4H3,(H2,24,25,26)/b21-16+<br /> | StdInChIKey = VJTXQHYNRDGLON-LTGZKZEYSA-N<br /> | bioavailability = <br /> | protein_bound = <br /> | metabolism = <br /> | elimination_half-life = <br /> | excretion = <br /> | pregnancy_AU = &lt;!-- A / B1 / B2 / B3 / C / D / X --&gt;<br /> | pregnancy_US = &lt;!-- A / B / C / D / X --&gt;<br /> | pregnancy_category= <br /> | legal_AU = &lt;!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--&gt;<br /> | legal_CA = &lt;!-- Schedule I, II, III, IV, V, VI, VII, VIII --&gt;<br /> | legal_UK = &lt;!-- GSL, P, POM, CD, or Class A, B, C --&gt;<br /> | legal_US = &lt;!-- OTC / Rx-only / Schedule I, II, III, IV, V --&gt;<br /> | legal_status = <br /> | routes_of_administration = <br /> }}<br /> <br /> &#039;&#039;&#039;Octotiamine&#039;&#039;&#039; ([[International Nonproprietary Name|INN]], [[Japanese Accepted Name|JAN]]; &#039;&#039;&#039;Gerostop&#039;&#039;&#039;, &#039;&#039;&#039;Neuvita&#039;&#039;&#039;, &#039;&#039;&#039;Neuvitan&#039;&#039;&#039;), also known as &#039;&#039;&#039;thioctothiamine&#039;&#039;&#039;, is an [[structural analogue|analogue]] of [[vitamin B1|vitamin B&lt;sub&gt;1&lt;/sub&gt;]] which is used in [[Japan]] and [[Finland]].<br /> <br /> ==See also==<br /> * [[Vitamin B1 analogue|Vitamin B&lt;sub&gt;1&lt;/sub&gt; analogue]]<br /> <br /> {{Vitamins}}<br /> <br /> {{二次利用|date=14 June 2023}}<br /> [[Category:Thiamine]]</div> FuzzyBot