Fire: Marked this version for translation

2024-04-03T01:32:54Z

Marked this version for translation

← Older revision		Revision as of 10:32, 3 April 2024
Line 1:		Line 1:
	<languages />		<languages />
	<translate>		<translate>
			<!--T:1-->
	{{Short description\|Chemical compound}}		{{Short description\|Chemical compound}}
	{{Drugbox		{{Drugbox
Line 37:		Line 38:
	}}		}}

			<!--T:2-->
	'''Octotiamine''' ([[International Nonproprietary Name\|INN]], [[Japanese Accepted Name\|JAN]]; '''Gerostop''', '''Neuvita''', '''Neuvitan'''), also known as '''thioctothiamine''', is an [[structural analogue\|analogue]] of [[vitamin B1\|vitamin B<sub>1</sub>]] which is used in [[Japan]] and [[Finland]].		'''Octotiamine''' ([[International Nonproprietary Name\|INN]], [[Japanese Accepted Name\|JAN]]; '''Gerostop''', '''Neuvita''', '''Neuvitan'''), also known as '''thioctothiamine''', is an [[structural analogue\|analogue]] of [[vitamin B1\|vitamin B<sub>1</sub>]] which is used in [[Japan]] and [[Finland]].

	==See also==		==See also== <!--T:3-->
	* [[Vitamin B1 analogue\|Vitamin B<sub>1</sub> analogue]]		* [[Vitamin B1 analogue\|Vitamin B<sub>1</sub> analogue]]

			<!--T:4-->
	{{Vitamins}}		{{Vitamins}}

			<!--T:5-->
	{{二次利用\|date=14 June 2023}}		{{二次利用\|date=14 June 2023}}
	[[Category:Thiamine]]		[[Category:Thiamine]]
	</translate>		</translate>

Fire: Created page with " {{Short description|Chemical compound}} {{Drugbox | IUPAC_name = methyl 6-(acetylsulfanyl)-8-{[(2E)-2-{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate | image = Octotiamine.svg | width = 250 | image2 = Octotiamine 3D.png | width2 = 160 | CAS_number = 137-86-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = UN1Q7096GA |..."

2024-04-03T01:30:29Z

Created page with "<languages /> <translate> {{Short description|Chemical compound}} {{Drugbox | IUPAC_name = methyl 6-(acetylsulfanyl)-8-<nowiki/>{[(2E)-2-<nowiki/>{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate | image = Octotiamine.svg | width = 250 | image2 = Octotiamine 3D.png | width2 = 160 | CAS_number = 137-86-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = UN1Q7096GA |..."

New page

<languages />
<translate>
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = methyl 6-(acetylsulfanyl)-8-<nowiki/>{[(2E)-2-<nowiki/>{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate
| image = Octotiamine.svg
| width = 250
| image2 = Octotiamine 3D.png
| width2 = 160
| CAS_number = 137-86-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UN1Q7096GA
| ATC_prefix = None
| ATC_suffix =
| PubChem = 3034020
| DrugBank =
| ChemSpiderID = 2298574
| chemical_formula =
| C=23 | H=36 | N=4 | O=5 | S=3
| SMILES = Cc1ncc(c(n1)N)CN(C=O)/C(=C(\CCO)/SSCCC(CCCCC(=O)OC)SC(=O)C)/C
| StdInChI = 1S/C23H36N4O5S3/c1-16(27(15-29)14-19-13-25-17(2)26-23(19)24)21(9-11-28)35-33-12-10-20(34-18(3)30)7-5-6-8-22(31)32-4/h13,15,20,28H,5-12,14H2,1-4H3,(H2,24,25,26)/b21-16+
| StdInChIKey = VJTXQHYNRDGLON-LTGZKZEYSA-N
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = 
| pregnancy_US = 
| pregnancy_category=
| legal_AU = 
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status =
| routes_of_administration =
}}

'''Octotiamine''' ([[International Nonproprietary Name|INN]], [[Japanese Accepted Name|JAN]]; '''Gerostop''', '''Neuvita''', '''Neuvitan'''), also known as '''thioctothiamine''', is an [[structural analogue|analogue]] of [[vitamin B1|vitamin B<sub>1</sub>]] which is used in [[Japan]] and [[Finland]].

==See also==
* [[Vitamin B1 analogue|Vitamin B<sub>1</sub> analogue]]

{{Vitamins}}

{{二次利用|date=14 June 2023}}
[[Category:Thiamine]]
</translate>

Octotiamine - Revision history

Fire: Marked this version for translation