https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Dihydrotachysterol%2Fen Dihydrotachysterol/en - Revision history 2026-07-09T13:00:43Z Revision history for this page on the wiki MediaWiki 1.43.0 https://wiki.tiffa.net/w/index.php?title=Dihydrotachysterol/en&diff=138395&oldid=prev FuzzyBot: Updating to match new version of source page 2024-04-12T13:28:34Z <p>Updating to match new version of source page</p> <p><b>New page</b></p><div>&lt;languages /&gt;<br /> {{Short description|Chemical compound}}<br /> {{Drugbox<br /> | verifiedrevid = 460787840<br /> | IUPAC_name = (1&#039;&#039;S&#039;&#039;,3&#039;&#039;E&#039;&#039;,4&#039;&#039;S&#039;&#039;)-3-[(2&#039;&#039;E&#039;&#039;)-2-[(1&#039;&#039;R&#039;&#039;,3a&#039;&#039;S&#039;&#039;,7a&#039;&#039;R&#039;&#039;)-1-[(&#039;&#039;E&#039;&#039;,2&#039;&#039;R&#039;&#039;,5&#039;&#039;R&#039;&#039;)-5,6-Dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1&#039;&#039;H&#039;&#039;-inden-4-ylidene]ethylidene]-4-methylcyclohexan-1-ol<br /> | image = Dihydrotachysterol.svg<br /> | alt = Structural formula<br /> | image2 = Dihydrotachysterol molecule spacefill.png<br /> | alt2 = Space-filling model of the dihydrotachysterol molecule<br /> | width = 190<br /> &lt;!--Clinical data--&gt;<br /> | tradename = <br /> | Drugs.com = {{drugs.com|CONS|dihydrotachysterol}}<br /> | MedlinePlus = a682335<br /> | pregnancy_AU = &lt;!-- A / B1 / B2 / B3 / C / D / X --&gt;<br /> | pregnancy_US = &lt;!-- A / B / C / D / X --&gt;<br /> | legal_AU = &lt;!-- Unscheduled / S2 / S4 / S8 --&gt;<br /> | legal_UK = &lt;!-- GSL / P / POM / CD --&gt;<br /> | legal_US = &lt;!-- OTC / Rx-only --&gt;<br /> &lt;!--Identifiers--&gt;<br /> | CAS_number_Ref = {{cascite|correct|??}}<br /> | CAS_number = 67-96-9<br /> | ATC_prefix = A11<br /> | ATC_suffix = CC02<br /> | PubChem = 5311071<br /> | DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br /> | DrugBank = DB01070<br /> | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br /> | ChemSpiderID = 4470607<br /> | UNII_Ref = {{fdacite|correct|FDA}}<br /> | UNII = R5LM3H112R<br /> | KEGG_Ref = {{keggcite|correct|kegg}}<br /> | KEGG = D00299<br /> | ChEBI_Ref = {{ebicite|correct|EBI}}<br /> | ChEBI = 4591<br /> &lt;!--Chemical data--&gt;<br /> | C=28 | H=46 | O=1<br /> | smiles = O[C@@H]3C/C(=C\C=C1/CCC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@H](C)CC3<br /> | StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br /> | StdInChI = 1S/C28H46O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-22,25-27,29H,7-8,11,14-18H2,1-6H3/b10-9+,23-12+,24-13+/t20-,21-,22+,25-,26+,27-,28+/m0/s1<br /> | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br /> | StdInChIKey = ILYCWAKSDCYMBB-OPCMSESCSA-N<br /> }}<br /> <br /> &#039;&#039;&#039;Dihydrotachysterol&#039;&#039;&#039; (DHT) is a synthetic [[vitamin D]] analog activated in the [[liver]] that does not require [[renal]] hydroxylation like vitamin D&lt;sub&gt;2&lt;/sub&gt; ([[ergocalciferol]]) and vitamin D&lt;sub&gt;3&lt;/sub&gt; ([[cholecalciferol]]). DHT has a rapid onset of action (2 hours), a shorter half-life, and a greater effect on [[Mineralization (biology)|mineralization]] of bone salts than does vitamin D.<br /> <br /> {{Sterols}}<br /> {{Vitamins}}<br /> {{Vitamin D receptor modulators}}<br /> <br /> {{二次利用|date=29 January 2023}}<br /> [[Category:Secosteroids]]<br /> [[Category:Vitamin D]]<br /> [[Category:Indanes]]<br /> [[Category:Conjugated dienes]]</div> FuzzyBot