Fire: Marked this version for translation

2024-04-12T13:28:08Z

Marked this version for translation

← Older revision		Revision as of 22:28, 12 April 2024
Line 1:		Line 1:
	<languages />		<languages />
	<translate>		<translate>
			<!--T:1-->
	{{Short description\|Chemical compound}}		{{Short description\|Chemical compound}}
	{{Drugbox		{{Drugbox
Line 44:		Line 45:
	}}		}}

			<!--T:2-->
	'''Dihydrotachysterol''' (DHT) is a synthetic [[vitamin D]] analog activated in the [[liver]] that does not require [[renal]] hydroxylation like vitamin D<sub>2</sub> ([[ergocalciferol]]) and vitamin D<sub>3</sub> ([[cholecalciferol]]). DHT has a rapid onset of action (2 hours), a shorter half-life, and a greater effect on [[Mineralization (biology)\|mineralization]] of bone salts than does vitamin D.		'''Dihydrotachysterol''' (DHT) is a synthetic [[vitamin D]] analog activated in the [[liver]] that does not require [[renal]] hydroxylation like vitamin D<sub>2</sub> ([[ergocalciferol]]) and vitamin D<sub>3</sub> ([[cholecalciferol]]). DHT has a rapid onset of action (2 hours), a shorter half-life, and a greater effect on [[Mineralization (biology)\|mineralization]] of bone salts than does vitamin D.

			<!--T:3-->
	{{Sterols}}		{{Sterols}}
	{{Vitamins}}		{{Vitamins}}
	{{Vitamin D receptor modulators}}		{{Vitamin D receptor modulators}}

			<!--T:4-->
	{{二次利用\|date=29 January 2023}}		{{二次利用\|date=29 January 2023}}
	[[Category:Secosteroids]]		[[Category:Secosteroids]]

Fire: Created page with " {{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 460787840 | IUPAC_name = (1''S'',3''E'',4''S'')-3-[(2''E'')-2-[(1''R'',3a''S'',7a''R'')-1-[(''E'',2''R'',5''R'')-5,6-Dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1''H''-inden-4-ylidene]ethylidene]-4-methylcyclohexan-1-ol | image = Dihydrotachysterol.svg | alt = Structural formula | image2 = Dihydrotachysterol molecule spacefill.png | alt2 = Space-filling model of the..."

2024-04-12T13:27:43Z

Created page with "<languages /> <translate> {{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 460787840 | IUPAC_name = (1''S'',3''E'',4''S'')-3-[(2''E'')-2-[(1''R'',3a''S'',7a''R'')-1-[(''E'',2''R'',5''R'')-5,6-Dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1''H''-inden-4-ylidene]ethylidene]-4-methylcyclohexan-1-ol | image = Dihydrotachysterol.svg | alt = Structural formula | image2 = Dihydrotachysterol molecule spacefill.png | alt2 = Space-filling model of the..."

New page

<languages />
<translate>
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 460787840
| IUPAC_name = (1''S'',3''E'',4''S'')-3-[(2''E'')-2-[(1''R'',3a''S'',7a''R'')-1-[(''E'',2''R'',5''R'')-5,6-Dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1''H''-inden-4-ylidene]ethylidene]-4-methylcyclohexan-1-ol
| image = Dihydrotachysterol.svg
| alt = Structural formula
| image2 = Dihydrotachysterol molecule spacefill.png
| alt2 = Space-filling model of the dihydrotachysterol molecule
| width = 190

| tradename =
| Drugs.com = {{drugs.com|CONS|dihydrotachysterol}}
| MedlinePlus = a682335
| pregnancy_AU = 
| pregnancy_US = 
| legal_AU = 
| legal_UK = 
| legal_US = 

| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 67-96-9
| ATC_prefix = A11
| ATC_suffix = CC02
| PubChem = 5311071
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01070
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4470607
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = R5LM3H112R
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00299
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 4591

| C=28 | H=46 | O=1
| smiles = O[C@@H]3C/C(=C\C=C1/CCC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@H](C)C(C)C)C)C)[C@@H](C)CC3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C28H46O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-22,25-27,29H,7-8,11,14-18H2,1-6H3/b10-9+,23-12+,24-13+/t20-,21-,22+,25-,26+,27-,28+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ILYCWAKSDCYMBB-OPCMSESCSA-N
}}

'''Dihydrotachysterol''' (DHT) is a synthetic [[vitamin D]] analog activated in the [[liver]] that does not require [[renal]] hydroxylation like vitamin D<sub>2</sub> ([[ergocalciferol]]) and vitamin D<sub>3</sub> ([[cholecalciferol]]). DHT has a rapid onset of action (2 hours), a shorter half-life, and a greater effect on [[Mineralization (biology)|mineralization]] of bone salts than does vitamin D.

{{Sterols}}
{{Vitamins}}
{{Vitamin D receptor modulators}}

{{二次利用|date=29 January 2023}}
[[Category:Secosteroids]]
[[Category:Vitamin D]]
[[Category:Indanes]]
[[Category:Conjugated dienes]]
</translate>

Dihydrotachysterol - Revision history

Fire: Marked this version for translation