Fire: Marked this version for translation

2024-04-02T23:30:56Z

Marked this version for translation

← Older revision		Revision as of 08:30, 3 April 2024
Line 1:		Line 1:
	<languages />		<languages />
	<translate>		<translate>
			<!--T:1-->
	{{Short description\|Chemical compound}}		{{Short description\|Chemical compound}}
	{{Drugbox		{{Drugbox
Line 11:		Line 12:
	\| alt2 = Ball-and-stick model of the allithiamine molecule		\| alt2 = Ball-and-stick model of the allithiamine molecule

			<!--T:2-->
	<!--Clinical data-->		<!--Clinical data-->
	\| tradename =		\| tradename =
Line 17:		Line 19:
	\| routes_of_administration =		\| routes_of_administration =

			<!--T:3-->
	<!--Pharmacokinetic data-->		<!--Pharmacokinetic data-->
	\| bioavailability =		\| bioavailability =
Line 23:		Line 26:
	\| excretion =		\| excretion =

			<!--T:4-->
	<!--Identifiers-->		<!--Identifiers-->
	\| CAS_number_Ref = {{cascite\|changed\|??}}		\| CAS_number_Ref = {{cascite\|changed\|??}}
Line 34:		Line 38:
	\| ChemSpiderID = 2301021		\| ChemSpiderID = 2301021

			<!--T:5-->
	<!--Chemical data-->		<!--Chemical data-->
	\| C=15 \| H=22 \| N=4 \| O=2 \| S=2		\| C=15 \| H=22 \| N=4 \| O=2 \| S=2
Line 43:		Line 48:
	}}		}}

			<!--T:6-->
	'''Allithiamine''' ('''thiamine allyl disulfide''' or '''TAD''') is a [[lipid]]-soluble form of [[vitamin B1\|vitamin B<sub>1</sub>]] which was discovered in [[garlic]] (''[[Allium sativum]]'') in the 1950s along with its [[Homologous series\|homolog]] [[prosultiamine]]. They were both investigated for their ability to treat [[Wernicke–Korsakoff syndrome]] and [[beriberi]] better than [[thiamine]].		'''Allithiamine''' ('''thiamine allyl disulfide''' or '''TAD''') is a [[lipid]]-soluble form of [[vitamin B1\|vitamin B<sub>1</sub>]] which was discovered in [[garlic]] (''[[Allium sativum]]'') in the 1950s along with its [[Homologous series\|homolog]] [[prosultiamine]]. They were both investigated for their ability to treat [[Wernicke–Korsakoff syndrome]] and [[beriberi]] better than [[thiamine]].

	== See also ==		== See also == <!--T:7-->
	* [[Vitamin B1 analogue\|Vitamin B<sub>1</sub> analogue]]		* [[Vitamin B1 analogue\|Vitamin B<sub>1</sub> analogue]]

			<!--T:8-->
	{{Vitamins}}		{{Vitamins}}

			<!--T:9-->
	{{二次利用\|date=18 October 2023}}		{{二次利用\|date=18 October 2023}}
	[[Category:Alkene derivatives]]		[[Category:Alkene derivatives]]

Fire: Created page with " {{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 477317772 | IUPAC_name = ''N''-[(4-Amino-2-methylpyrimidin-5-yl)methyl]-''N''-[(1''Z'')-4-hydroxy-1-methyl-2-(prop-2-en-1-yldisulfanyl)but-1-en-1-yl]formamide | image = Allithiamine.png | alt = Skeletal formula of allithiamine | image2 = Allithiamine_3D_ball.png | alt2 = Ball-and-stick model of the allithiamine molecule | tradenam..."

2024-04-02T23:29:20Z

Created page with "<languages /> <translate> {{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 477317772 | IUPAC_name = ''N''-[(4-Amino-2-methylpyrimidin-5-yl)methyl]-''N''-[(1''Z'')-4-hydroxy-1-methyl-2-(prop-2-en-1-yldisulfanyl)but-1-en-1-yl]formamide | image = Allithiamine.png | alt = Skeletal formula of allithiamine | image2 = Allithiamine_3D_ball.png | alt2 = Ball-and-stick model of the allithiamine molecule  | tradenam..."

New page

<languages />
<translate>
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 477317772
| IUPAC_name = ''N''-[(4-Amino-2-methylpyrimidin-5-yl)methyl]-''N''-[(1''Z'')-4-hydroxy-1-methyl-2-(prop-2-en-1-yldisulfanyl)but-1-en-1-yl]formamide
| image = Allithiamine.png
| alt = Skeletal formula of allithiamine
| image2 = Allithiamine_3D_ball.png
| alt2 = Ball-and-stick model of the allithiamine molecule


| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =


| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =


| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 554-44-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 83SWN21920
| ATC_prefix = None
| ATC_suffix =
| PubChem = 3037212
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2301021


| C=15 | H=22 | N=4 | O=2 | S=2
| smiles = O=CN(/C(=C(\SSC\C=C)CCO)C)Cc1cnc(nc1N)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H22N4O2S2/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16/h4,8,10,20H,1,5-7,9H2,2-3H3,(H2,16,17,18)/b14-11-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WNCAVNGLACHSRZ-KAMYIIQDSA-N
}}

'''Allithiamine''' ('''thiamine allyl disulfide''' or '''TAD''') is a [[lipid]]-soluble form of [[vitamin B1|vitamin B<sub>1</sub>]] which was discovered in [[garlic]] (''[[Allium sativum]]'') in the 1950s along with its [[Homologous series|homolog]] [[prosultiamine]]. They were both investigated for their ability to treat [[Wernicke–Korsakoff syndrome]] and [[beriberi]] better than [[thiamine]].

== See also ==
* [[Vitamin B1 analogue|Vitamin B<sub>1</sub> analogue]]

{{Vitamins}}

{{二次利用|date=18 October 2023}}
[[Category:Alkene derivatives]]
[[Category:Formamides]]
[[Category:Organic disulfides]]
[[Category:Pyrimidines]]
[[Category:Thiamine]]
[[Category:Allyl compounds]]
</translate>

Allithiamine - Revision history

Fire: Marked this version for translation