FuzzyBot: Updating to match new version of source page

2024-04-12T13:22:25Z

Updating to match new version of source page

New page

<languages />
{{chembox
| Verifiedfields = changed
| verifiedrevid = 477317096
| ImageFile=alfacalcidol.png
| ImageFile2=Alfacalcidol ball-and-stick.png
| PIN=(1''R'',3''S'',5''Z'')-4-Methylidene-5-[(2''E'')-2-<nowiki/>{(1''R'',3a''S'',7a''R'')-7a-methyl-1-[(2''R'')-6-methylheptan-2-yl]octahydro-4''H''-inden-4-ylidene}ethylidene]cyclohexane-1,3-diol
| OtherNames=Alphacalcidol; 1-Hydroxycholecalciferol
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = URQ2517572
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 31186
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 32540
| InChI = 1/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| InChIKey = OFHCOWSQAMBJIW-AVJTYSNKBM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OFHCOWSQAMBJIW-AVJTYSNKSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=41294-56-8
| PubChem=5282181
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445376
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01518
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01436
| SMILES = O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C
}}
|Section2={{Chembox Properties
| Formula=C27H44O2
| MolarMass=400.64 g/mol
| Appearance=
| Density=
| MeltingPtC= 136
| BoilingPt=
| Solubility= 0.016 g/100 mL
}}
| Section6 = {{Chembox Pharmacology
| Pharmacology_ref =
| ATCCode_prefix = A11
| ATCCode_suffix = CC03
| ATC_Supplemental =
| ATCvet =
| Licence_EU = yes
| INN =
| INN_EMA =
| Licence_US =
| Legal_status =
| Legal_AU =
| Legal_AU_comment =
| Legal_CA =
| Legal_CA_comment =
| Legal_NZ =
| Legal_NZ_comment =
| Legal_UK = POM
| Legal_UK_comment =
| Legal_US =
| Legal_US_comment =
| Legal_EU = Rx-only
| Legal_EU_comment =
| Legal_UN =
| Legal_UN_comment =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_AU_comment =
| Dependence_liability =
| AdminRoutes =
| Bioavail =
| ProteinBound =
| Metabolism =
| Metabolites =
| OnsetOfAction =
| HalfLife =
| DurationOfAction =
| Excretion =
}}
|Section7={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}

'''Alfacalcidol''' (or '''1-hydroxycholecalciferol''') is an analogue of [[vitamin D]] used for supplementation in humans and as a poultry feed additive.

Alfacalcidol has a weaker impact on [[calcium metabolism]] than [[calcitriol]]; but significant effects on the [[immune system]], including [[regulatory T cells]]. It is considered to be a more useful form of [[vitamin D]] supplementation, mostly due to much longer half-life and lower kidney load. It is the most commonly prescribed vitamin D metabolite for patients with [[end stage renal disease]], given that impaired renal function alters the ability to carry out the second [[hydroxylation]] step required for the formation of the physiologically active form of vitamin D, [[1,25-dihydroxyvitamin D3]]. Alfacalcidol is an active vitamin D3 metabolite, and therefore does not require the second [[hydroxylation]] step in the [[kidney]].


It was patented in 1971 and approved for medical use in 1978.

==Trade names==
Pharmaceutical trade names include AlphaD and One-Alpha.

==Other animals==
Used as a poultry feed additive, it prevents [[tibial dyschondroplasia]] and increases [[phytate]] [[bioavailability]].

{{Vitamins}}
{{Vitamin D receptor modulators}}

{{二次利用|date=13 December 2023}}
[[Category:Secosteroids]]
[[Category:Vitamin D]]
[[Category:Vinylidene compounds]]

Alfacalcidol/en - Revision history

FuzzyBot: Updating to match new version of source page